missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sudan III (chromatographic standard), Thermo Scientific™
Marca: Thermo Scientific Alfa Aesar A11461.22
| Quantità | 100 g |
|---|
Questo articolo non è restituibile.
Consulta la politica di reso
Descrizione
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identificatori chimici
| 85-86-9 | |
| 352.397 | |
| HTPQPMPFXUWUOT-UHFFFAOYSA-N | |
| 6789251 | |
| C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NN=C3C(=O)C=CC4=CC=CC=C43 |
| C22H16N4O | |
| MFCD00003905 | |
| C.I. 26100; Solvent Red 23 | |
| 1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one |
Specifica
| Sudan III (chromatographic standard) | |
| 85-86-9 | |
| MFCD00003905 | |
| 14,8884 | |
| HTPQPMPFXUWUOT-UHFFFAOYSA-N | |
| 1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one | |
| 6789251 | |
| 100 g |
| ∼200°C (decomposition) | |
| C22H16N4O | |
| 931185 | |
| C.I. 26100; Solvent Red 23 | |
| C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NN=C3C(=O)C=CC4=CC=CC=C43 | |
| 352.397 | |
| 352.4 |
Correzione del contenuto del prodotto
Fornite il vostro feedback sul contenuto del prodotto compilando il modulo sottostante.
Titolo del prodotto
Individuate un'opportunità di miglioramento?Condividi una correzione di contenuto