missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Starch, for analysis, soluble, Thermo Scientific Chemicals
64.39€ - 605.01€
Identificatori chimici
| CAS | 9005-84-9 |
|---|---|
| Formula molecolare | C12H22O11 |
| Molecular Weight (g/mol) | 342.297 |
| Numero MDL | MFCD00082026 |
| InChI Key | GUBGYTABKSRVRQ-ASMJPISFSA-N |
| Sinonimo | alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose |
| PubChem CID | 439341 |
| ChEBI | CHEBI:18167 |
| IUPAC Name | 2-(hydroxymethyl)-6-{[4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol |
| SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|---|---|---|---|---|---|---|---|---|---|
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|
10572581
|
Thermo Scientific Acros
177132500 |
250 g | Plastic bottle |
64.39€
250g |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
|
10337980
|
Thermo Scientific Acros
177130010 |
1 kg | Plastic bottle |
175.88€
1kg |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
|
10424605
|
Thermo Scientific Acros
177130050 |
5 kg | Plastic drum |
605.01€
5kg |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
Descrizione
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identificatori chimici
| 9005-84-9 | |
| 342.297 | |
| GUBGYTABKSRVRQ-ASMJPISFSA-N | |
| 439341 | |
| 2-(hydroxymethyl)-6-{[4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol |
| C12H22O11 | |
| MFCD00082026 | |
| alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
| CHEBI:18167 | |
| C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
Specifica
| Starch | |
| Soluble, For analysis | |
| 9005-84-9 | |
| 256.0°C to 258.0°C | |
| MFCD00082026 | |
| alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
| GUBGYTABKSRVRQ-ASMJPISFSA-N | |
| 2-(hydroxymethyl)-6-{[4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol | |
| 439341 | |
| Analytical | |
| Authentic | |
| passes |
| White | |
| 5 to 7.5 (2% soln. at 25°C) | |
| Amorphous Powder | |
| C12H22O11 | |
| 15, 8926 | |
| Solubility in water: 50g/L (90°C). | |
| C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O | |
| 342.297 | |
| CHEBI:18167 | |
| positive | |
| 10% max. |
RUO – Research Use Only
Individuate un'opportunità di miglioramento?Condividi una correzione di contenuto
Correzione del contenuto del prodotto
Fornite il vostro feedback sul contenuto del prodotto compilando il modulo sottostante.
Titolo del prodotto