missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Kaliumdichromat, ≥99.5 %, Reagenzienqualität, Honeywell™
Reagenzgütegrad, ≥99.5 %
37.26 € - 148.19 €
Chemische Identifikatoren
| CAS | 7778-50-9 |
|---|---|
| Summenformel | Cr2K2O7 |
| Molekulargewicht (g/mol) | 294.182 |
| MDL-Nummer | MFCD00011367 |
| InChI-Schlüssel | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Synonym | Kaliumdichromat, Kaliumbichromat, Iopezit, Dikaliumbichromat, Kaliumdichromat VI, Phthalsäure-Dikaliumsalz, Dikaliumdichromium-Heptaoxid, Kalibichromat, dipotassium dichromium heptaoxide, bichromate of potash |
| PubChem CID | 24502 |
| ChEBI | CHEBI:53444 |
| IUPAC-Name | Dikalium; Oxido-(Oxido(dioxo)chromio)oxy-dioxochrom |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Produktcode | Marke | Menge | Verpackung | Preis | Menge & Verfügbarkeit | ||||
|---|---|---|---|---|---|---|---|---|---|
| Produktcode | Marke | Menge | Verpackung | Preis | Menge & Verfügbarkeit | ||||
|
15608040
|
Honeywell Research Chemicals
P5271-25G |
25 g | Poly-Flasche | N/A | |||||
|
15628040
|
Honeywell Research Chemicals
P5271-500G |
500 g | Poly-Flasche | N/A | |||||
|
15618040
|
Honeywell Research Chemicals
P5271-2KG |
2 kg | Poly-Flasche | N/A | |||||
Beschreibung
- ≥95 % für den allgemeinen Laboreinsatz
Chemische Identifikatoren
| 7778-50-9 | |
| 294.182 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| Dikalium; Oxido-(Oxido(dioxo)chromio)oxy-dioxochrom |
| Cr2K2O7 | |
| MFCD00011367 | |
| Kaliumdichromat, Kaliumbichromat, Iopezit, Dikaliumbichromat, Kaliumdichromat VI, Phthalsäure-Dikaliumsalz, Dikaliumdichromium-Heptaoxid, Kalibichromat, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
Spezifikation
| Kaliumdichromat | |
| 7778-50-9 | |
| 3.5 (bei 20 °C) | |
| K2Cr2O7 | |
| UN3086 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| Dikalium; Oxido-(Oxido(dioxo)chromio)oxy-dioxochrom | |
| 24502 | |
| 294.18 mol | |
| Geruchsneutral | |
| 2.7 g/cu.cm bei 20 °C |
| 398 °C | |
| Orange | |
| Cr2K2O7 | |
| MFCD00011367 | |
| Kaliumdichromat, Kaliumbichromat, Iopezit, Dikaliumbichromat, Kaliumdichromat VI, Phthalsäure-Dikaliumsalz, Dikaliumdichromium-Heptaoxid, Kalibichromat, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| ≥ 99.5 % | |
| Kristallin |
Sicherheit und Handhabung
Fehlende Gruppe - N15.00950417-P201-P280-P304 + P340 + P310-P305 + P351 + P338-P308 + P313
missing translation for 'dotInformation' : Klasse 6.1 - PG 2 - EHS - RQ - Giftige Feststoffe, oxidierend, n.o.s., HI: Alle
missing translation for 'rtecsNumber' : 231-906-6
Haben Sie Verbesserungsvorschläge?Übermitteln Sie eine inhaltliche Korrektur
Berichtigung von Produktinhalten
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.
Name des Produkts