missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Phenolphthalein, ACS reagent
CAS: 77-09-8 | C20H14O4 | 318.33 g/mol
Marca: Thermo Scientific Chemicals 417180026
296.23 EUR valido fino al 2025-12-31
Usa il codice promo "25339" per avere il tuo prezzo promozionale.
| Quantità | 2.5 kg |
|---|---|
| Imballaggio | Plastic bottle |
vedi altre versioni di questo prodotto
Questo articolo non è restituibile.
Consulta la politica di reso
Descrizione
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Indicator
Identificatori chimici
| 77-09-8 | |
| 318.33 | |
| KJFMBFZCATUALV-UHFFFAOYSA-N | |
| CHEBI:34914 |
| C20H14O4 | |
| MFCD00005913 | |
| 4764 | |
| OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
Specifica
| Phenolphthalein | |
| 77-09-8 | |
| C20H14O4 | |
| 18, 143 | |
| Solubility in water: <0.1%. Other solubilities: 1g/12mL alcohol, 1g/100mL ether, soluble in alkalies, soluble in chloroform | |
| Authentic | |
| 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one | |
| 4764 | |
| 318.32 | |
| Plastic bottle | |
| from pH 8.0 (colorless) to pH 10 (red) | |
| White | |
| Crystalline Powder |
| 258.0°C to 263.0°C | |
| Passes Test | |
| MFCD00005913 | |
| 15, 7356 | |
| KJFMBFZCATUALV-UHFFFAOYSA-N | |
| OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 | |
| 318.33 | |
| CHEBI:34914 | |
| Reagente ACS | |
| Vapor Pressure: Negligible | |
| 1.299g/mL | |
| 2.5 kg |
Correzione del contenuto del prodotto
Fornite il vostro feedback sul contenuto del prodotto compilando il modulo sottostante.
Titolo del prodotto
Individuate un'opportunità di miglioramento?Condividi una correzione di contenuto