missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Nile Red, 99%, pure
CAS: 7385-67-3 | C20H18N2O2 | 318.38 g/mol
139.00€ - 885.00€
Identificatori chimici
| CAS | 7385-67-3 |
|---|---|
| Formula molecolare | C20H18N2O2 |
| Molecular Weight (g/mol) | 318.38 |
| Numero MDL | MFCD00011639 |
| InChI Key | VOFUROIFQGPCGE-UHFFFAOYSA-N |
| Sinonimo | Nile blue A oxazone |
| PubChem CID | 65182 |
| ChEBI | CHEBI:52169 |
| SMILES | CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31 |
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|---|---|---|---|---|---|---|---|---|---|
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|
10464311
|
Thermo Scientific Chemicals
415711000 |
100 mg | Glass bottle |
139.00€
100mg |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
|
10658904
|
Thermo Scientific Chemicals
415710010 |
1 g | Glass bottle |
885.00€
1g |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
Descrizione
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identificatori chimici
| 7385-67-3 | |
| 318.38 | |
| VOFUROIFQGPCGE-UHFFFAOYSA-N | |
| 65182 | |
| CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31 |
| C20H18N2O2 | |
| MFCD00011639 | |
| Nile blue A oxazone | |
| CHEBI:52169 |
Specifica
| Nile Red | |
| 99% | |
| 98.5 | |
| 99% | |
| MFCD00011639 | |
| 15, 6628 | |
| Solubility in water: almost insoluble. Other solubilities: soluble in acetone, acetonitrile, chloroform, thf,, ethanol, dmso, cs2, benzene, nitrobenzene, pyridin, e, hexane, diethyl ether | |
| Authentic | |
| 9-(diethylamino)benzo[a]phenoxazin-5-one | |
| 65182 | |
| 318.38 | |
| Pure | |
| Complies | |
| Powder |
| 203.0°C to 205.0°C | |
| 7385-67-3 | |
| 100.0 | |
| C20H18N2O2 | |
| 27, II, 468 | |
| Nile blue A oxazone | |
| VOFUROIFQGPCGE-UHFFFAOYSA-N | |
| CCN(CC)C1=CC=C2N=C3C(OC2=C1)=CC(=O)C1=CC=CC=C31 | |
| 318.38 | |
| CHEBI:52169 | |
| 99% | |
| 98.5% min. | |
| Maroon to Red |
Sicurezza e movimentazione
missing translation for 'einecsNumber' : 230-966-0
missing translation for 'tsca' : TSCA
Identificativo prodotto
- Nile Red
RUO – Research Use Only
Individuate un'opportunità di miglioramento?Condividi una correzione di contenuto
Correzione del contenuto del prodotto
Fornite il vostro feedback sul contenuto del prodotto compilando il modulo sottostante.
Titolo del prodotto