missing translation for 'onlineSavingsMsg'
Learn More
Learn More
HEPES (Fine White Crystals/Molecular Biology), Fisher BioReagents™
Commonly used buffering agent.
Marca: Fisher BioReagents BP310-5
Questo articolo non è restituibile.
Consulta la politica di reso
Descrizione
Agente tamponante molto diffuso
HEPES è comunemente usato come agente tamponante.
Specifica
| 0.01 max. (0.1M solution) at 280nm | |
| 7365-45-9 | |
| 5.0 to 6.5 | |
| 5 kg | |
| N-2-Hydroxyethylpiperazine-N-2-Ethane Sulfonic Acid | |
| ≥99 % | |
| C8H18N2O4S | |
| Secchio in polietilene | |
| 15, 4689 | |
| Soluble in water | |
| OCCN1CCN(CCS(O)(=O)=O)CC1 | |
| 238.30 | |
| CHEBI:42334 | |
| Biologia molecolare |
| HEPES | |
| White | |
| Crystals | |
| Esente da DNasi | |
| DNase-, RNase- and Protease-Free | |
| Pass Test | |
| MFCD00006158 | |
| Protease free | |
| N-(2-Hydroxyethyl)piperazine-N«-2-ethanesulfonic Acid | |
| JKMHFZQWWAIEOD-UHFFFAOYSA-N | |
| 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid | |
| 23831 | |
| ≥99% |
Seguridad y manipulación
Nombre del producto
- HEPES
Corrección del contenido de un producto
Proporcione sus comentarios sobre el contenido del producto rellenando el siguiente formulario.
Título del producto
¿Detecta una oportunidad de mejora?Comparta una corrección de contenido