missing translation for 'onlineSavingsMsg'
Learn More
Learn More
D-Sucrose (Molecular Biology), Fisher BioReagents
For the preparation of density gradients for DNA ultracentrifugation
33.20€ - 170.00€
Identificatori chimici
| CAS | 57-50-1 |
|---|---|
| Formula molecolare | C12H22O11 |
| Molecular Weight (g/mol) | 342.30 |
| Numero MDL | MFCD00006626 |
| InChI Key | CZMRCDWAGMRECN-PWPRYFECNA-N |
| Sinonimo | sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand |
| PubChem CID | 5988 |
| ChEBI | CHEBI:17992 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-diidrossi-2,5-bis(idrossimetil)ossolan-2-il]osso-6-(idrossimetil)ossano-3,4,5-triolo |
| SMILES | OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|---|---|---|---|---|---|---|---|---|---|
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|
10638403
|
Fisher BioReagents
BP220-1 |
1 kg | Poly Bottle |
33.20€
1kg |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
|
10346893
|
Fisher BioReagents
BP220-212 |
2.5 kg | Glass Bottle |
75.70€
2.50kg |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
|
10051413
|
Fisher BioReagents
BP220-10 |
10 kg | Poly Pail |
170.00€
10kg |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
Descrizione
D-Sucrose is suitable for the preparation of density gradients used in purification of proteins and nucleic acids by ultracentrifugation.Identificatori chimici
| 57-50-1 | |
| 342.30 | |
| CZMRCDWAGMRECN-PWPRYFECNA-N | |
| 5988 | |
| (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-diidrossi-2,5-bis(idrossimetil)ossolan-2-il]osso-6-(idrossimetil)ossano-3,4,5-triolo |
| C12H22O11 | |
| MFCD00006626 | |
| sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand | |
| CHEBI:17992 | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
Specifica
| Sucrose | |
| 57-50-1 | |
| White | |
| 0.01% max. | |
| DNase-, RNase- and Protease-Free | |
| C12H22O11 | |
| 15, 9012 | |
| sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand | |
| CZMRCDWAGMRECN-PWPRYFECNA-N | |
| (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-diidrossi-2,5-bis(idrossimetil)ossolan-2-il]osso-6-(idrossimetil)ossano-3,4,5-triolo | |
| 5988 | |
| 342.29 | |
| Biologia molecolare |
| D-Sucrose | |
| 190°C | |
| 6.5 to 7.5 | |
| 0.03% max. | |
| ≥99.9% | |
| MFCD00006626 | |
| +66 to +67° (+ or -) | |
| 0.005% max. Insoluble Matter | |
| OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O | |
| 342.30 | |
| CHEBI:17992 | |
| ≥99.9% | |
| Solid |
Sicurezza e movimentazione
CAUTION!
Emergency Overview
May cause skin, eye, and respiratory tract irritation. Wear personal protective equipment. Ensure adequate ventilation. Avoid contact with skin, eyes and clothing. Avoid ingestion and inhalation. Use personal protective equipment. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. If breathing is difficult, give oxygen. Get medical attention immediately if symptoms occur.
NFPA
Health:1
Flammability:1
Instability:0
Recommended Storage : RT
Individuate un'opportunità di miglioramento?Condividi una correzione di contenuto
Correzione del contenuto del prodotto
Fornite il vostro feedback sul contenuto del prodotto compilando il modulo sottostante.
Titolo del prodotto