Learn More
Cefazolin sodium salt
Inhibits bacterial cell wall synthesis | CAS: 27164-46-1 | C14H16N8NaO4S3 | 479.504 g/mol
Marca: Thermo Scientific Alfa Aesar J65274.03
108.00 EUR valido fino al 2025-12-31
Usa il codice promo "25339" per avere il tuo prezzo promozionale.
Quantità | 1 g |
---|
Descrizione
Inhibits bacterial cell wall synthesis
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.

Identificatori chimici
27164-46-1 | |
479.504 | |
MTIAAUXSENDLGW-SLNAEPSVSA-N | |
131673922 | |
[HH].CC1=NN=C(S1)SCC2=C(N3C(C(C3=O)NC(=O)CN4C=NN=N4)SC2)C(=O)O.[Na] |
C14H16N8NaO4S3 | |
MFCD00056883 | |
Cefamedin | |
(6R,7R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;molecular hydrogen;sodium |
Specifica
Cefazolin sodium salt | |
Powder | |
170°C to 172°C | |
1 g | |
C14H16N8NaO4S3 | |
3585038 | |
Cefamedin | |
[HH].CC1=NN=C(S1)SCC2=C(N3C(C(C3=O)NC(=O)CN4C=NN=N4)SC2)C(=O)O.[Na] | |
479.504 | |
476.48 |
Cefazolin Sodium Salt | |
27164-46-1 | |
White | |
Light sensitive | |
MFCD00056883 | |
14,1917 | |
MTIAAUXSENDLGW-SLNAEPSVSA-N | |
(6R,7R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;molecular hydrogen;sodium | |
131673922 |
Fornite il vostro feedback sul contenuto del prodotto compilando il modulo sottostante.