missing translation for 'onlineSavingsMsg'
Learn More
Learn More
5-Hydroxyindole-3-acetic Acid, 99%, Thermo Scientific Chemicals
CAS: 54-16-0 | C10H9NO3 | 191.19 g/mol
77.90€ - 666.00€
Identificatori chimici
| CAS | 54-16-0 |
|---|---|
| Formula molecolare | C10H9NO3 |
| Molecular Weight (g/mol) | 191.19 |
| Numero MDL | MFCD00005639 |
| InChI Key | DUUGKQCEGZLZNO-UHFFFAOYSA-N |
| Sinonimo | 5-hydroxyindole-3-acetic acid, 5-hiaa, 2-5-hydroxy-1h-indol-3-yl acetic acid, 5-hydroxyindoleacetic acid, 5-hydroxyheteroauxin, 5-hydroxy-1h-indol-3-yl acetic acid, 5-oxyindoleacetic acid, hydroxyindoleacetic acid, 5-hydroxy-iaa, 5-hydroxyindol-3-ylacetic acid |
| PubChem CID | 1826 |
| ChEBI | CHEBI:27823 |
| IUPAC Name | 2-(5-hydroxy-1H-indol-3-yl)acetic acid |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)CC(=O)O |
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|---|---|---|---|---|---|---|---|---|---|
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|
10235160
|
Thermo Scientific Acros
121282500 |
250 mg | Bottiglia in vetro |
77.90€
250mg |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
|
10793861
|
Thermo Scientific Acros
121280010 |
1 g | Bottiglia in vetro |
209.00€
1g |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
|
10524074
|
Thermo Scientific Acros
121280050 |
5 g | Bottiglia in vetro |
666.00€
5g |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
Descrizione
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identificatori chimici
| 54-16-0 | |
| 191.19 | |
| DUUGKQCEGZLZNO-UHFFFAOYSA-N | |
| 1826 | |
| 2-(5-hydroxy-1H-indol-3-yl)acetic acid |
| C10H9NO3 | |
| MFCD00005639 | |
| 5-hydroxyindole-3-acetic acid, 5-hiaa, 2-5-hydroxy-1h-indol-3-yl acetic acid, 5-hydroxyindoleacetic acid, 5-hydroxyheteroauxin, 5-hydroxy-1h-indol-3-yl acetic acid, 5-oxyindoleacetic acid, hydroxyindoleacetic acid, 5-hydroxy-iaa, 5-hydroxyindol-3-ylacetic acid | |
| CHEBI:27823 | |
| C1=CC2=C(C=C1O)C(=CN2)CC(=O)O |
Specifica
| 5-Hydroxyindole-3-acetic acid | |
| 98.5 | |
| 162°C to 165°C | |
| Authentic | |
| C10H9NO3 | |
| 5-hydroxyindole-3-acetic acid, 5-hiaa, 2-5-hydroxy-1h-indol-3-yl acetic acid, 5-hydroxyindoleacetic acid, 5-hydroxyheteroauxin, 5-hydroxy-1h-indol-3-yl acetic acid, 5-oxyindoleacetic acid, hydroxyindoleacetic acid, 5-hydroxy-iaa, 5-hydroxyindol-3-ylacetic acid | |
| DUUGKQCEGZLZNO-UHFFFAOYSA-N | |
| 2-(5-hydroxy-1H-indol-3-yl)acetic acid | |
| 1826 | |
| 191.19 | |
| Crystalline Powder |
| 54-16-0 | |
| 100.0 | |
| Beige | |
| 99% | |
| MFCD00005639 | |
| Solubility in water: slightly soluble | |
| C1=CC2=C(C=C1O)C(=CN2)CC(=O)O | |
| 191.19 | |
| CHEBI:27823 | |
| 99% |
Sicurezza e movimentazione
missing translation for 'einecsNumber' : 200-195-4
RUO – Research Use Only
Individuate un'opportunità di miglioramento?Condividi una correzione di contenuto
Correzione del contenuto del prodotto
Fornite il vostro feedback sul contenuto del prodotto compilando il modulo sottostante.
Titolo del prodotto